C27H31NO — CID 132593528
3-(4-ethylanilino)-1-(4-methylphenyl)-3-(4-propan-2-ylphenyl)propan-1-one (PubChem CID 132593528) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is 3-(4-ethylanilino)-1-(4-methylphenyl)-3-(4-propan-2-ylphenyl)propan-1-one.
| Compound Name | 3-(4-ethylanilino)-1-(4-methylphenyl)-3-(4-propan-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 132593528 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-(4-ethylanilino)-1-(4-methylphenyl)-3-(4-propan-2-ylphenyl)propan-1-one |
| SMILES | CCc1ccc(NC(CC(=O)c2ccc(C)cc2)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO/c1-5-21-8-16-25(17-9-21)28-26(23-14-12-22(13-15-23)19(2)3)18-27(29)24-10-6-20(4)7-11-24/h6-17,19,26,28H,5,18H2,1-4H3 |
| InChIKey | MJHAHPRPYGCMDG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |