C28H31NO3 — CID 7033990
methyl 4-[(1R)-1-(4-butylanilino)-3-(4-methylphenyl)-3-oxopropyl]benzoate (PubChem CID 7033990) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl 4-[(1R)-1-(4-butylanilino)-3-(4-methylphenyl)-3-oxopropyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-(4-butylanilino)-3-(4-methylphenyl)-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 7033990 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | methyl 4-[(1R)-1-(4-butylanilino)-3-(4-methylphenyl)-3-oxopropyl]benzoate |
| SMILES | CCCCc1ccc(N[C@H](CC(=O)c2ccc(C)cc2)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-4-5-6-21-9-17-25(18-10-21)29-26(19-27(30)23-11-7-20(2)8-12-23)22-13-15-24(16-14-22)28(31)32-3/h7-18,26,29H,4-6,19H2,1-3H3/t26-/m1/s1 |
| InChIKey | JEMQJMOSYVNDHX-AREMUKBSSA-N |
| XLogP | 6.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |