C21H16Cl2FNO — CID 7034447
(3S)-1,3-bis(4-chlorophenyl)-3-(4-fluoroanilino)propan-1-one (PubChem CID 7034447) has the molecular formula C21H16Cl2FNO and a molecular weight of 388.27 g/mol. Its IUPAC name is (3S)-1,3-bis(4-chlorophenyl)-3-(4-fluoroanilino)propan-1-one.
| Compound Name | (3S)-1,3-bis(4-chlorophenyl)-3-(4-fluoroanilino)propan-1-one |
|---|---|
| PubChem CID | 7034447 |
| Molecular Formula | C21H16Cl2FNO |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (3S)-1,3-bis(4-chlorophenyl)-3-(4-fluoroanilino)propan-1-one |
| SMILES | O=C(C[C@H](Nc1ccc(F)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2FNO/c22-16-5-1-14(2-6-16)20(25-19-11-9-18(24)10-12-19)13-21(26)15-3-7-17(23)8-4-15/h1-12,20,25H,13H2/t20-/m0/s1 |
| InChIKey | XPAZEKFTPDJNTB-FQEVSTJZSA-N |
| XLogP | 6.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |