C22H19ClFNO — CID 40978401
(3S)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-3-(3-methylanilino)propan-1-one (PubChem CID 40978401) has the molecular formula C22H19ClFNO and a molecular weight of 367.85 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-3-(3-methylanilino)propan-1-one.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-3-(3-methylanilino)propan-1-one |
|---|---|
| PubChem CID | 40978401 |
| Molecular Formula | C22H19ClFNO |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-3-(3-methylanilino)propan-1-one |
| SMILES | Cc1cccc(N[C@@H](CC(=O)c2ccc(Cl)cc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19ClFNO/c1-15-3-2-4-20(13-15)25-21(16-7-11-19(24)12-8-16)14-22(26)17-5-9-18(23)10-6-17/h2-13,21,25H,14H2,1H3/t21-/m0/s1 |
| InChIKey | JCLQEDYCXSKMOS-NRFANRHFSA-N |
| XLogP | 6.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |