C26H22INO — CID 132592552
3-(4-iodoanilino)-3-(4-methylphenyl)-1-naphthalen-2-ylpropan-1-one (PubChem CID 132592552) has the molecular formula C26H22INO and a molecular weight of 491.37 g/mol. Its IUPAC name is 3-(4-iodoanilino)-3-(4-methylphenyl)-1-naphthalen-2-ylpropan-1-one.
| Compound Name | 3-(4-iodoanilino)-3-(4-methylphenyl)-1-naphthalen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 132592552 |
| Molecular Formula | C26H22INO |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 3-(4-iodoanilino)-3-(4-methylphenyl)-1-naphthalen-2-ylpropan-1-one |
| SMILES | Cc1ccc(C(CC(=O)c2ccc3ccccc3c2)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C26H22INO/c1-18-6-8-20(9-7-18)25(28-24-14-12-23(27)13-15-24)17-26(29)22-11-10-19-4-2-3-5-21(19)16-22/h2-16,25,28H,17H2,1H3 |
| InChIKey | ZGWYGFJZZOACDW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|