C22H18Cl2INO2 — CID 132592182
3-(3,4-dichlorophenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one (PubChem CID 132592182) has the molecular formula C22H18Cl2INO2 and a molecular weight of 526.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 132592182 |
| Molecular Formula | C22H18Cl2INO2 |
| Molecular Weight | 526.20 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CC(Nc2ccc(I)cc2)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H18Cl2INO2/c1-28-18-9-2-14(3-10-18)22(27)13-21(15-4-11-19(23)20(24)12-15)26-17-7-5-16(25)6-8-17/h2-12,21,26H,13H2,1H3 |
| InChIKey | VZRLRHSEMTUAPU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.20 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|