C22H19ClN2O4 — CID 132592060
3-(4-chloroanilino)-3-(4-methoxy-3-nitrophenyl)-1-phenylpropan-1-one (PubChem CID 132592060) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 3-(4-chloroanilino)-3-(4-methoxy-3-nitrophenyl)-1-phenylpropan-1-one.
| Compound Name | 3-(4-chloroanilino)-3-(4-methoxy-3-nitrophenyl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 132592060 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-(4-chloroanilino)-3-(4-methoxy-3-nitrophenyl)-1-phenylpropan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)Nc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19ClN2O4/c1-29-22-12-7-16(13-20(22)25(27)28)19(24-18-10-8-17(23)9-11-18)14-21(26)15-5-3-2-4-6-15/h2-13,19,24H,14H2,1H3 |
| InChIKey | UIMLDJUSTIETEX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|