C26H28N2O6 — CID 132592312
1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)-3-(4-methoxy-3-nitrophenyl)propan-1-one (PubChem CID 132592312) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)-3-(4-methoxy-3-nitrophenyl)propan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)-3-(4-methoxy-3-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 132592312 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)-3-(4-methoxy-3-nitrophenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CC(Nc2ccc(C)c(C)c2)c2ccc(OC)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C26H28N2O6/c1-16-6-9-20(12-17(16)2)27-21(18-7-10-24(32-3)22(13-18)28(30)31)15-23(29)19-8-11-25(33-4)26(14-19)34-5/h6-14,21,27H,15H2,1-5H3 |
| InChIKey | ZBYBYLVANRLAOK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|