C26H26N2O5 — CID 26314626
(3S)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-3-(4-nitroanilino)propan-1-one (PubChem CID 26314626) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (3S)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-3-(4-nitroanilino)propan-1-one.
| Compound Name | (3S)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-3-(4-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 26314626 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3S)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-3-(4-nitroanilino)propan-1-one |
| SMILES | CC(C)(C)c1ccc([C@H](CC(=O)c2ccc3c(c2)OCO3)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H26N2O5/c1-26(2,3)19-7-4-17(5-8-19)22(27-20-9-11-21(12-10-20)28(30)31)15-23(29)18-6-13-24-25(14-18)33-16-32-24/h4-14,22,27H,15-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | IPYMILWKSDRFAW-QFIPXVFZSA-N |
| XLogP | 6.05 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|