C21H22Cl2N2O3 — CID 46906231
3-cyclohexyl-1-(3,4-dichlorophenyl)-3-(4-nitroanilino)propan-1-one (PubChem CID 46906231) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3,4-dichlorophenyl)-3-(4-nitroanilino)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(3,4-dichlorophenyl)-3-(4-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 46906231 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-cyclohexyl-1-(3,4-dichlorophenyl)-3-(4-nitroanilino)propan-1-one |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])cc1)C1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H22Cl2N2O3/c22-18-11-6-15(12-19(18)23)21(26)13-20(14-4-2-1-3-5-14)24-16-7-9-17(10-8-16)25(27)28/h6-12,14,20,24H,1-5,13H2 |
| InChIKey | CLZXITGNUVWIEP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|