C27H27FN2O3 — CID 46906563
1-(4-cyclohexylphenyl)-3-(3-fluorophenyl)-3-(4-nitroanilino)propan-1-one (PubChem CID 46906563) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3-(3-fluorophenyl)-3-(4-nitroanilino)propan-1-one.
| Compound Name | 1-(4-cyclohexylphenyl)-3-(3-fluorophenyl)-3-(4-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 46906563 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-3-(3-fluorophenyl)-3-(4-nitroanilino)propan-1-one |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])cc1)c1cccc(F)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H27FN2O3/c28-23-8-4-7-22(17-23)26(29-24-13-15-25(16-14-24)30(32)33)18-27(31)21-11-9-20(10-12-21)19-5-2-1-3-6-19/h4,7-17,19,26,29H,1-3,5-6,18H2 |
| InChIKey | IEVTWPPTWHIEGU-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|