C10H9Cl3N2O3 — CID 775030
(3R)-3-amino-4,4,4-trichloro-1-(4-nitrophenyl)butan-1-one (PubChem CID 775030) has the molecular formula C10H9Cl3N2O3 and a molecular weight of 311.55 g/mol. Its IUPAC name is (3R)-3-amino-4,4,4-trichloro-1-(4-nitrophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-4,4,4-trichloro-1-(4-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 775030 |
| Molecular Formula | C10H9Cl3N2O3 |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | (3R)-3-amino-4,4,4-trichloro-1-(4-nitrophenyl)butan-1-one |
| SMILES | N[C@H](CC(=O)c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3N2O3/c11-10(12,13)9(14)5-8(16)6-1-3-7(4-2-6)15(17)18/h1-4,9H,5,14H2/t9-/m1/s1 |
| InChIKey | CTBPJQRKQDPECC-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|