C9H7Cl3N2O4 — CID 786413
4-nitro-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzamide (PubChem CID 786413) has the molecular formula C9H7Cl3N2O4 and a molecular weight of 313.52 g/mol. Its IUPAC name is 4-nitro-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzamide.
| Compound Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 786413 |
| Molecular Formula | C9H7Cl3N2O4 |
| Molecular Weight | 313.52 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzamide |
| SMILES | O=C(N[C@H](O)C(Cl)(Cl)Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7Cl3N2O4/c10-9(11,12)8(16)13-7(15)5-1-3-6(4-2-5)14(17)18/h1-4,8,16H,(H,13,15)/t8-/m1/s1 |
| InChIKey | XOVBJXQYZBZXFC-MRVPVSSYSA-N |
| XLogP | 2.01 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|