C19H20N4O6 — CID 4047461
N-[2,2-dimethyl-3-[(4-nitrobenzoyl)amino]propyl]-4-nitrobenzamide (PubChem CID 4047461) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-[(4-nitrobenzoyl)amino]propyl]-4-nitrobenzamide.
| Compound Name | N-[2,2-dimethyl-3-[(4-nitrobenzoyl)amino]propyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4047461 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[2,2-dimethyl-3-[(4-nitrobenzoyl)amino]propyl]-4-nitrobenzamide |
| SMILES | CC(C)(CNC(=O)c1ccc([N+](=O)[O-])cc1)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O6/c1-19(2,11-20-17(24)13-3-7-15(8-4-13)22(26)27)12-21-18(25)14-5-9-16(10-6-14)23(28)29/h3-10H,11-12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | JMQKBXWYNHMIED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|