C11H13N3O4 — CID 9224321
N-[2-(ethylamino)-2-oxoethyl]-4-nitrobenzamide (PubChem CID 9224321) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9224321 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCNC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13N3O4/c1-2-12-10(15)7-13-11(16)8-3-5-9(6-4-8)14(17)18/h3-6H,2,7H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | CDFJGBYPKZBOJB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|