C23H34N6O7 — CID 102479572
N-[2-[[(2S)-1-[[2-[[(2S)-1-(hexylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 102479572) has the molecular formula C23H34N6O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-[2-[[(2S)-1-[[2-[[(2S)-1-(hexylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[[(2S)-1-[[2-[[(2S)-1-(hexylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 102479572 |
| Molecular Formula | C23H34N6O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[2-[[(2S)-1-[[2-[[(2S)-1-(hexylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCCCCCNC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](C)NC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N6O7/c1-4-5-6-7-12-24-21(32)15(2)27-19(30)13-25-22(33)16(3)28-20(31)14-26-23(34)17-8-10-18(11-9-17)29(35)36/h8-11,15-16H,4-7,12-14H2,1-3H3,(H,24,32)(H,25,33)(H,26,34)(H,27,30)(H,28,31)/t15-,16-/m0/s1 |
| InChIKey | SKMVLQXXTGJQRG-HOTGVXAUSA-N |
| XLogP | 0.15 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|