C14H17N3O6 — CID 52988701
methyl 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]propanoate (PubChem CID 52988701) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is methyl 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]propanoate.
| Compound Name | methyl 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 52988701 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | methyl 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O6/c1-9(14(20)23-2)16-12(18)7-8-15-13(19)10-3-5-11(6-4-10)17(21)22/h3-6,9H,7-8H2,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | ZKAFUQBDFYTQDH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|