C16H21N3O6S — CID 51065010
methyl 4-methylsulfanyl-2-[3-[(4-nitrobenzoyl)amino]propanoylamino]butanoate (PubChem CID 51065010) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-[3-[(4-nitrobenzoyl)amino]propanoylamino]butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-[3-[(4-nitrobenzoyl)amino]propanoylamino]butanoate |
|---|---|
| PubChem CID | 51065010 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl 4-methylsulfanyl-2-[3-[(4-nitrobenzoyl)amino]propanoylamino]butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O6S/c1-25-16(22)13(8-10-26-2)18-14(20)7-9-17-15(21)11-3-5-12(6-4-11)19(23)24/h3-6,13H,7-10H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | VKIZFGFKEYIXBF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|