C14H19N3O5S — CID 9432010
methyl (2S)-2-[[4-(methylamino)-3-nitrobenzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 9432010) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(methylamino)-3-nitrobenzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(methylamino)-3-nitrobenzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9432010 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | methyl (2S)-2-[[4-(methylamino)-3-nitrobenzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CNc1ccc(C(=O)N[C@@H](CCSC)C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O5S/c1-15-10-5-4-9(8-12(10)17(20)21)13(18)16-11(6-7-23-3)14(19)22-2/h4-5,8,11,15H,6-7H2,1-3H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | HDMOSYPSFXDWFK-NSHDSACASA-N |
| XLogP | 1.66 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|