C13H15N3O8S — CID 2834845
4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)amino]-3,5-dinitrobenzoic acid (PubChem CID 2834845) has the molecular formula C13H15N3O8S and a molecular weight of 373.34 g/mol. Its IUPAC name is 4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)amino]-3,5-dinitrobenzoic acid.
| Compound Name | 4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)amino]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 2834845 |
| Molecular Formula | C13H15N3O8S |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)amino]-3,5-dinitrobenzoic acid |
| SMILES | COC(=O)C(CCSC)Nc1c([N+](=O)[O-])cc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O8S/c1-24-13(19)8(3-4-25-2)14-11-9(15(20)21)5-7(12(17)18)6-10(11)16(22)23/h5-6,8,14H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | INCFGGQHLCJJMN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|