C13H17N3O6S — CID 7060364
methyl (2S)-2-(4-methyl-2,6-dinitroanilino)-4-methylsulfanylbutanoate (PubChem CID 7060364) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl (2S)-2-(4-methyl-2,6-dinitroanilino)-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-(4-methyl-2,6-dinitroanilino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7060364 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | methyl (2S)-2-(4-methyl-2,6-dinitroanilino)-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)Nc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O6S/c1-8-6-10(15(18)19)12(11(7-8)16(20)21)14-9(4-5-23-3)13(17)22-2/h6-7,9,14H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | NGBNHLXIZOMLKU-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|