C13H15N3O7S — CID 2213237
methyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2213237) has the molecular formula C13H15N3O7S and a molecular weight of 357.34 g/mol. Its IUPAC name is methyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2213237 |
| Molecular Formula | C13H15N3O7S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | methyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N3O7S/c1-23-13(18)11(3-4-24-2)14-12(17)8-5-9(15(19)20)7-10(6-8)16(21)22/h5-7,11H,3-4H2,1-2H3,(H,14,17)/t11-/m0/s1 |
| InChIKey | HCSNOKSOBLCQTI-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|