C25H28N4O10S2 — CID 21122114
(4-nitrophenyl) (2S)-4-methylsulfanyl-2-[[3-[[(2S)-4-methylsulfanyl-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-3-oxopropanoyl]amino]butanoate (PubChem CID 21122114) has the molecular formula C25H28N4O10S2 and a molecular weight of 608.65 g/mol. Its IUPAC name is (4-nitrophenyl) (2S)-4-methylsulfanyl-2-[[3-[[(2S)-4-methylsulfanyl-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-3-oxopropanoyl]amino]butanoate.
| Compound Name | (4-nitrophenyl) (2S)-4-methylsulfanyl-2-[[3-[[(2S)-4-methylsulfanyl-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-3-oxopropanoyl]amino]butanoate |
|---|---|
| PubChem CID | 21122114 |
| Molecular Formula | C25H28N4O10S2 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | (4-nitrophenyl) (2S)-4-methylsulfanyl-2-[[3-[[(2S)-4-methylsulfanyl-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-3-oxopropanoyl]amino]butanoate |
| SMILES | CSCC[C@H](NC(=O)CC(=O)N[C@@H](CCSC)C(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28N4O10S2/c1-40-13-11-20(24(32)38-18-7-3-16(4-8-18)28(34)35)26-22(30)15-23(31)27-21(12-14-41-2)25(33)39-19-9-5-17(6-10-19)29(36)37/h3-10,20-21H,11-15H2,1-2H3,(H,26,30)(H,27,31)/t20-,21-/m0/s1 |
| InChIKey | IEQBPFRDKNVLGN-SFTDATJTSA-N |
| XLogP | 2.88 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|