C19H18Cl2N2O5S — CID 2493644
(4-nitrophenyl)methyl (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2493644) has the molecular formula C19H18Cl2N2O5S and a molecular weight of 457.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (4-nitrophenyl)methyl (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2493644 |
| Molecular Formula | C19H18Cl2N2O5S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18Cl2N2O5S/c1-29-9-8-17(22-18(24)15-7-4-13(20)10-16(15)21)19(25)28-11-12-2-5-14(6-3-12)23(26)27/h2-7,10,17H,8-9,11H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | IDHVLWPMUODDKC-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|