C20H19ClN2O6S — CID 2092044
phenacyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2092044) has the molecular formula C20H19ClN2O6S and a molecular weight of 450.90 g/mol. Its IUPAC name is phenacyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | phenacyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2092044 |
| Molecular Formula | C20H19ClN2O6S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | phenacyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O6S/c1-30-10-9-17(20(26)29-12-18(24)13-5-3-2-4-6-13)22-19(25)15-8-7-14(23(27)28)11-16(15)21/h2-8,11,17H,9-10,12H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | XIUOSNPGLCNSGK-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|