C20H19Cl3N4O6S — CID 98347320
[(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 98347320) has the molecular formula C20H19Cl3N4O6S and a molecular weight of 549.82 g/mol. Its IUPAC name is [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 98347320 |
| Molecular Formula | C20H19Cl3N4O6S |
| Molecular Weight | 549.82 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)O[C@@H](C)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl3N4O6S/c1-10(18(28)26-17-15(23)7-11(21)9-24-17)33-20(30)16(5-6-34-2)25-19(29)13-4-3-12(27(31)32)8-14(13)22/h3-4,7-10,16H,5-6H2,1-2H3,(H,25,29)(H,24,26,28)/t10-,16-/m0/s1 |
| InChIKey | SYSIFMNHLYTTJH-QFYYESIMSA-N |
| XLogP | 4.37 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|