C14H19ClN4O4S — CID 9164071
2-chloro-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 9164071) has the molecular formula C14H19ClN4O4S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9164071 |
| Molecular Formula | C14H19ClN4O4S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-chloro-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)NN(C)C |
| InChI | InChI=1S/C14H19ClN4O4S/c1-18(2)17-14(21)12(6-7-24-3)16-13(20)10-5-4-9(19(22)23)8-11(10)15/h4-5,8,12H,6-7H2,1-3H3,(H,16,20)(H,17,21)/t12-/m0/s1 |
| InChIKey | PHZIMQVCQPKUDL-LBPRGKRZSA-N |
| XLogP | 1.69 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|