C22H24ClN3O6S — CID 2571832
2-chloro-N-[(2R)-1-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 2571832) has the molecular formula C22H24ClN3O6S and a molecular weight of 493.97 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-1-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2R)-1-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2571832 |
| Molecular Formula | C22H24ClN3O6S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-chloro-N-[(2R)-1-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)N(C)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H24ClN3O6S/c1-25(13-14-3-6-19-20(11-14)32-9-8-31-19)22(28)18(7-10-33-2)24-21(27)16-5-4-15(26(29)30)12-17(16)23/h3-6,11-12,18H,7-10,13H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | UDBNNSKFTJSJLE-GOSISDBHSA-N |
| XLogP | 3.53 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|