C18H19ClN4O6S — CID 6216075
[(E)-4-amino-3-cyano-2-oxopent-3-enyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 6216075) has the molecular formula C18H19ClN4O6S and a molecular weight of 454.89 g/mol. Its IUPAC name is [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 6216075 |
| Molecular Formula | C18H19ClN4O6S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCC(=O)/C(C#N)=C(\C)N |
| InChI | InChI=1S/C18H19ClN4O6S/c1-10(21)13(8-20)16(24)9-29-18(26)15(5-6-30-2)22-17(25)12-4-3-11(23(27)28)7-14(12)19/h3-4,7,15H,5-6,9,21H2,1-2H3,(H,22,25)/b13-10+ |
| InChIKey | JVROJKNPXXILOT-JLHYYAGUSA-N |
| XLogP | 1.97 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|