C20H18ClN3O5S2 — CID 2480198
1,3-benzothiazol-2-ylmethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2480198) has the molecular formula C20H18ClN3O5S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2480198 |
| Molecular Formula | C20H18ClN3O5S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18ClN3O5S2/c1-30-9-8-16(23-19(25)13-7-6-12(24(27)28)10-14(13)21)20(26)29-11-18-22-15-4-2-3-5-17(15)31-18/h2-7,10,16H,8-9,11H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | OVENQBQVEKNQRG-INIZCTEOSA-N |
| XLogP | 4.45 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|