C21H19ClN2O5S2 — CID 43035847
(3-chloro-1-benzothiophen-2-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 43035847) has the molecular formula C21H19ClN2O5S2 and a molecular weight of 478.98 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 43035847 |
| Molecular Formula | C21H19ClN2O5S2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H19ClN2O5S2/c1-30-10-9-16(23-20(25)13-5-4-6-14(11-13)24(27)28)21(26)29-12-18-19(22)15-7-2-3-8-17(15)31-18/h2-8,11,16H,9-10,12H2,1H3,(H,23,25) |
| InChIKey | FFVFQWSMMOWVIF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|