C16H21N3O6S — CID 119221525
3-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]butanoic acid (PubChem CID 119221525) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is 3-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]butanoic acid.
| Compound Name | 3-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119221525 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NC(C)CC(=O)O |
| InChI | InChI=1S/C16H21N3O6S/c1-10(8-14(20)21)17-16(23)13(6-7-26-2)18-15(22)11-4-3-5-12(9-11)19(24)25/h3-5,9-10,13H,6-8H2,1-2H3,(H,17,23)(H,18,22)(H,20,21) |
| InChIKey | KPKFNIIGKKQXDV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|