C17H23N3O6S — CID 119228782
2-methyl-3-[methyl-[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]propanoic acid (PubChem CID 119228782) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119228782 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-methyl-3-[methyl-[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]propanoic acid |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C17H23N3O6S/c1-11(17(23)24)10-19(2)16(22)14(7-8-27-3)18-15(21)12-5-4-6-13(9-12)20(25)26/h4-6,9,11,14H,7-8,10H2,1-3H3,(H,18,21)(H,23,24) |
| InChIKey | AZMILTPCJJWMNU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|