C24H29N3O6S — CID 55400254
[2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55400254) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55400254 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CCc1ccc(CN(C)C(=O)COC(=O)C(CCSC)NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H29N3O6S/c1-4-17-8-10-18(11-9-17)15-26(2)22(28)16-33-24(30)21(12-13-34-3)25-23(29)19-6-5-7-20(14-19)27(31)32/h5-11,14,21H,4,12-13,15-16H2,1-3H3,(H,25,29) |
| InChIKey | OGULRLIWOUNDNJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|