C21H21F2N3O7S — CID 55324060
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55324060) has the molecular formula C21H21F2N3O7S and a molecular weight of 497.48 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55324060 |
| Molecular Formula | C21H21F2N3O7S |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H21F2N3O7S/c1-34-10-9-17(25-19(28)13-3-2-4-15(11-13)26(30)31)20(29)32-12-18(27)24-14-5-7-16(8-6-14)33-21(22)23/h2-8,11,17,21H,9-10,12H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | VPQNUAMJIYYHJE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|