C21H23N3O7S — CID 55323985
[2-(2-methoxyanilino)-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55323985) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55323985 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)C(CCSC)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O7S/c1-30-18-9-4-3-8-16(18)22-19(25)13-31-21(27)17(10-11-32-2)23-20(26)14-6-5-7-15(12-14)24(28)29/h3-9,12,17H,10-11,13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | LQSWBAZLAMVBAO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|