C21H29N3O6S — CID 55324112
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55324112) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55324112 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCC(=O)NC1CCCCC1C |
| InChI | InChI=1S/C21H29N3O6S/c1-14-6-3-4-9-17(14)22-19(25)13-30-21(27)18(10-11-31-2)23-20(26)15-7-5-8-16(12-15)24(28)29/h5,7-8,12,14,17-18H,3-4,6,9-11,13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | GTDUXTMAMOQNGE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|