C23H32N4O5S — CID 55340269
N-[4-methylsulfanyl-1-oxo-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]butan-2-yl]-3-nitrobenzamide (PubChem CID 55340269) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]butan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]butan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55340269 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]butan-2-yl]-3-nitrobenzamide |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H32N4O5S/c1-33-15-10-20(24-21(28)18-6-5-7-19(16-18)27(31)32)23(30)26-13-8-17(9-14-26)22(29)25-11-3-2-4-12-25/h5-7,16-17,20H,2-4,8-15H2,1H3,(H,24,28) |
| InChIKey | RXKVKFWYUMNLMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|