C25H32N4O4S — CID 55845552
N-[1-[4-[(4-methylpiperidin-1-yl)methyl]anilino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 55845552) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[1-[4-[(4-methylpiperidin-1-yl)methyl]anilino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[4-[(4-methylpiperidin-1-yl)methyl]anilino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55845552 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[1-[4-[(4-methylpiperidin-1-yl)methyl]anilino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(CN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-18-10-13-28(14-11-18)17-19-6-8-21(9-7-19)26-25(31)23(12-15-34-2)27-24(30)20-4-3-5-22(16-20)29(32)33/h3-9,16,18,23H,10-15,17H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | ZLLLTMBWVVULID-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|