C22H23ClN4O5S — CID 55971177
2-chloro-N-cyclopropyl-4-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]benzamide (PubChem CID 55971177) has the molecular formula C22H23ClN4O5S and a molecular weight of 490.97 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-4-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-4-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 55971177 |
| Molecular Formula | C22H23ClN4O5S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-chloro-N-cyclopropyl-4-[[4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoyl]amino]benzamide |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(C(=O)NC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H23ClN4O5S/c1-33-10-9-19(26-20(28)13-3-2-4-16(11-13)27(31)32)22(30)25-15-7-8-17(18(23)12-15)21(29)24-14-5-6-14/h2-4,7-8,11-12,14,19H,5-6,9-10H2,1H3,(H,24,29)(H,25,30)(H,26,28) |
| InChIKey | SINDMBAVEZRMQD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|