C17H17ClN4O4S — CID 25384273
2-chloro-N-[(2R)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylamino)butan-2-yl]-4-nitrobenzamide (PubChem CID 25384273) has the molecular formula C17H17ClN4O4S and a molecular weight of 408.87 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylamino)butan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2R)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylamino)butan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 25384273 |
| Molecular Formula | C17H17ClN4O4S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-chloro-N-[(2R)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylamino)butan-2-yl]-4-nitrobenzamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C17H17ClN4O4S/c1-27-9-6-15(17(24)20-11-4-7-19-8-5-11)21-16(23)13-3-2-12(22(25)26)10-14(13)18/h2-5,7-8,10,15H,6,9H2,1H3,(H,21,23)(H,19,20,24)/t15-/m1/s1 |
| InChIKey | ISPYBEFVBIDCDL-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|