C20H20ClN3O6S — CID 43039996
(2-amino-2-oxo-1-phenylethyl) 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 43039996) has the molecular formula C20H20ClN3O6S and a molecular weight of 465.92 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 43039996 |
| Molecular Formula | C20H20ClN3O6S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O6S/c1-31-10-9-16(20(27)30-17(18(22)25)12-5-3-2-4-6-12)23-19(26)14-8-7-13(24(28)29)11-15(14)21/h2-8,11,16-17H,9-10H2,1H3,(H2,22,25)(H,23,26) |
| InChIKey | BPLNVXYXMVQWQT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|