C17H15ClN2O5 — CID 18104474
methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-phenylpropanoate (PubChem CID 18104474) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18104474 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H15ClN2O5/c1-25-17(22)15(9-11-5-3-2-4-6-11)19-16(21)13-8-7-12(20(23)24)10-14(13)18/h2-8,10,15H,9H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | AYGOYWAIWYZKBX-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|