C22H19ClN2O3 — CID 55588452
2-chloro-N-(1,1-diphenylpropan-2-yl)-4-nitrobenzamide (PubChem CID 55588452) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-chloro-N-(1,1-diphenylpropan-2-yl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(1,1-diphenylpropan-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 55588452 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-chloro-N-(1,1-diphenylpropan-2-yl)-4-nitrobenzamide |
| SMILES | CC(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19ClN2O3/c1-15(24-22(26)19-13-12-18(25(27)28)14-20(19)23)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,21H,1H3,(H,24,26) |
| InChIKey | ABODICNBAWJXNN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|