C11H13ClN2O4S — CID 113415401
2-chloro-N-(1-methylsulfinylpropan-2-yl)-4-nitrobenzamide (PubChem CID 113415401) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 2-chloro-N-(1-methylsulfinylpropan-2-yl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(1-methylsulfinylpropan-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 113415401 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-chloro-N-(1-methylsulfinylpropan-2-yl)-4-nitrobenzamide |
| SMILES | CC(CS(C)=O)NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H13ClN2O4S/c1-7(6-19(2)18)13-11(15)9-4-3-8(14(16)17)5-10(9)12/h3-5,7H,6H2,1-2H3,(H,13,15) |
| InChIKey | XWPSTCSVPLRCGJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|