C17H24ClN3O3 — CID 60574124
2-chloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-4-nitrobenzamide (PubChem CID 60574124) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 60574124 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-chloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-4-nitrobenzamide |
| SMILES | CC1CC(C)CN(CC(C)NC(=O)c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-11-6-12(2)9-20(8-11)10-13(3)19-17(22)15-5-4-14(21(23)24)7-16(15)18/h4-5,7,11-13H,6,8-10H2,1-3H3,(H,19,22) |
| InChIKey | IQOPPFMLRDXKET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|