C17H16Cl2N2O4 — CID 91517144
methyl (2S)-2-[(4-amino-3,5-dichloro-2-hydroxybenzoyl)amino]-3-phenylpropanoate (PubChem CID 91517144) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is methyl (2S)-2-[(4-amino-3,5-dichloro-2-hydroxybenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(4-amino-3,5-dichloro-2-hydroxybenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91517144 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | methyl (2S)-2-[(4-amino-3,5-dichloro-2-hydroxybenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(Cl)c(N)c(Cl)c1O |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-25-17(24)12(7-9-5-3-2-4-6-9)21-16(23)10-8-11(18)14(20)13(19)15(10)22/h2-6,8,12,22H,7,20H2,1H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | NJMYEQJEJBNHED-LBPRGKRZSA-N |
| XLogP | 2.80 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|