C16H13Cl2NO5 — CID 22094782
2-[(3,5-dichloro-2,4-dihydroxybenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 22094782) has the molecular formula C16H13Cl2NO5 and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2,4-dihydroxybenzoyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[(3,5-dichloro-2,4-dihydroxybenzoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22094782 |
| Molecular Formula | C16H13Cl2NO5 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[(3,5-dichloro-2,4-dihydroxybenzoyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1cc(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C16H13Cl2NO5/c17-10-7-9(13(20)12(18)14(10)21)15(22)19-11(16(23)24)6-8-4-2-1-3-5-8/h1-5,7,11,20-21H,6H2,(H,19,22)(H,23,24) |
| InChIKey | BRSSTNAKVDDSJA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |