C19H20ClNO4 — CID 174997492
acetyl chloride;2-[(2-methylbenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 174997492) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is acetyl chloride;2-[(2-methylbenzoyl)amino]-3-phenylpropanoic acid.
| Compound Name | acetyl chloride;2-[(2-methylbenzoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174997492 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | acetyl chloride;2-[(2-methylbenzoyl)amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)Cl.Cc1ccccc1C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H17NO3.C2H3ClO/c1-12-7-5-6-10-14(12)16(19)18-15(17(20)21)11-13-8-3-2-4-9-13;1-2(3)4/h2-10,15H,11H2,1H3,(H,18,19)(H,20,21);1H3 |
| InChIKey | FFJUFPXYJISDTE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|