C21H24Cl2N2O5 — CID 58647158
(2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 58647158) has the molecular formula C21H24Cl2N2O5 and a molecular weight of 455.34 g/mol. Its IUPAC name is (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58647158 |
| Molecular Formula | C21H24Cl2N2O5 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | CNCCCCOc1c(Cl)cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)O)c(O)c1Cl |
| InChI | InChI=1S/C21H24Cl2N2O5/c1-24-9-5-6-10-30-19-15(22)12-14(18(26)17(19)23)20(27)25-16(21(28)29)11-13-7-3-2-4-8-13/h2-4,7-8,12,16,24,26H,5-6,9-11H2,1H3,(H,25,27)(H,28,29)/t16-/m0/s1 |
| InChIKey | ZZEKJLQKKCKMAA-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|